C8H20NO5P — CID 10377028
[(2S)-3-amino-2-hydroxypropyl]-(diethoxymethyl)phosphinic acid (PubChem CID 10377028) has the molecular formula C8H20NO5P and a molecular weight of 241.22 g/mol. Its IUPAC name is [(2S)-3-amino-2-hydroxypropyl]-(diethoxymethyl)phosphinic acid.
| Compound Name | [(2S)-3-amino-2-hydroxypropyl]-(diethoxymethyl)phosphinic acid |
|---|---|
| PubChem CID | 10377028 |
| Molecular Formula | C8H20NO5P |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | [(2S)-3-amino-2-hydroxypropyl]-(diethoxymethyl)phosphinic acid |
| SMILES | CCOC(OCC)P(=O)(O)C[C@@H](O)CN |
| InChI | InChI=1S/C8H20NO5P/c1-3-13-8(14-4-2)15(11,12)6-7(10)5-9/h7-8,10H,3-6,9H2,1-2H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | ZPQZCSLTMACLHC-ZETCQYMHSA-N |
| XLogP | -0.07 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|