About 1-aminoheptan-2-ol;phosphoric acid
1-aminoheptan-2-ol;phosphoric acid (PubChem CID 174932535) has the molecular formula C7H20NO5P
and a molecular weight of 229.21 g/mol. Its IUPAC name is 1-aminoheptan-2-ol;phosphoric acid.
Molecular Properties
| Compound Name | 1-aminoheptan-2-ol;phosphoric acid |
| PubChem CID | 174932535 |
| Molecular Formula | C7H20NO5P |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-aminoheptan-2-ol;phosphoric acid |
| SMILES | CCCCCC(O)CN.O=P(O)(O)O |
| InChI | InChI=1S/C7H17NO.H3O4P/c1-2-3-4-5-7(9)6-8;1-5(2,3)4/h7,9H,2-6,8H2,1H3;(H3,1,2,3,4) |
| InChIKey | WTKZUJJUMZGIBR-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoheptan-2-ol;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoheptan-2-ol;phosphoric acid?
The IUPAC name of 1-aminoheptan-2-ol;phosphoric acid (CID 174932535) is 1-aminoheptan-2-ol;phosphoric acid.
What is the SMILES notation for 1-aminoheptan-2-ol;phosphoric acid?
The canonical SMILES for 1-aminoheptan-2-ol;phosphoric acid is CCCCCC(O)CN.O=P(O)(O)O.
What is the InChIKey of 1-aminoheptan-2-ol;phosphoric acid?
The InChIKey is WTKZUJJUMZGIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO.H3O4P/c1-2-3-4-5-7(9)6-8;1-5(2,3)4/h7,9H,2-6,8H2,1H3;(H3,1,2,3,4).
What are the key properties of 1-aminoheptan-2-ol;phosphoric acid?
1-aminoheptan-2-ol;phosphoric acid has a molecular weight of 229.21 g/mol, XLogP of -0.04, 5 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoheptan-2-ol;phosphoric acid is sourced from PubChem (CID 174932535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).