About 1-aminotetradecan-2-ol;sulfuric acid
1-aminotetradecan-2-ol;sulfuric acid (PubChem CID 158919972) has the molecular formula C14H33NO5S
and a molecular weight of 327.49 g/mol. Its IUPAC name is 1-aminotetradecan-2-ol;sulfuric acid.
Molecular Properties
| Compound Name | 1-aminotetradecan-2-ol;sulfuric acid |
| PubChem CID | 158919972 |
| Molecular Formula | C14H33NO5S |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-aminotetradecan-2-ol;sulfuric acid |
| SMILES | CCCCCCCCCCCCC(O)CN.O=S(=O)(O)O |
| InChI | InChI=1S/C14H31NO.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-14(16)13-15;1-5(2,3)4/h14,16H,2-13,15H2,1H3;(H2,1,2,3,4) |
| InChIKey | JHSDUZHFPUCLBY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminotetradecan-2-ol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminotetradecan-2-ol;sulfuric acid?
The IUPAC name of 1-aminotetradecan-2-ol;sulfuric acid (CID 158919972) is 1-aminotetradecan-2-ol;sulfuric acid.
What is the SMILES notation for 1-aminotetradecan-2-ol;sulfuric acid?
The canonical SMILES for 1-aminotetradecan-2-ol;sulfuric acid is CCCCCCCCCCCCC(O)CN.O=S(=O)(O)O.
What is the InChIKey of 1-aminotetradecan-2-ol;sulfuric acid?
The InChIKey is JHSDUZHFPUCLBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-14(16)13-15;1-5(2,3)4/h14,16H,2-13,15H2,1H3;(H2,1,2,3,4).
What are the key properties of 1-aminotetradecan-2-ol;sulfuric acid?
1-aminotetradecan-2-ol;sulfuric acid has a molecular weight of 327.49 g/mol, XLogP of 2.96, 12 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminotetradecan-2-ol;sulfuric acid is sourced from PubChem (CID 158919972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).