About (2R)-1-aminooctan-2-ol
(2R)-1-aminooctan-2-ol (PubChem CID 13476237) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is (2R)-1-aminooctan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-aminooctan-2-ol |
| PubChem CID | 13476237 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | (2R)-1-aminooctan-2-ol |
| SMILES | CCCCCC[C@@H](O)CN |
| InChI | InChI=1S/C8H19NO/c1-2-3-4-5-6-8(10)7-9/h8,10H,2-7,9H2,1H3/t8-/m1/s1 |
| InChIKey | MPGVRLGIUWFEPA-MRVPVSSYSA-N |
| XLogP | 1.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-aminooctan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-aminooctan-2-ol?
The IUPAC name of (2R)-1-aminooctan-2-ol (CID 13476237) is (2R)-1-aminooctan-2-ol.
What is the SMILES notation for (2R)-1-aminooctan-2-ol?
The canonical SMILES for (2R)-1-aminooctan-2-ol is CCCCCC[C@@H](O)CN.
What is the InChIKey of (2R)-1-aminooctan-2-ol?
The InChIKey is MPGVRLGIUWFEPA-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H19NO/c1-2-3-4-5-6-8(10)7-9/h8,10H,2-7,9H2,1H3/t8-/m1/s1.
What are the key properties of (2R)-1-aminooctan-2-ol?
(2R)-1-aminooctan-2-ol has a molecular weight of 145.25 g/mol, XLogP of 1.28, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-aminooctan-2-ol is sourced from PubChem (CID 13476237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).