C18H39O7P — CID 14740209
2-[bis(2,2-diethoxyethyl)phosphoryl]-1,1-diethoxyethane (PubChem CID 14740209) has the molecular formula C18H39O7P and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[bis(2,2-diethoxyethyl)phosphoryl]-1,1-diethoxyethane.
| Compound Name | 2-[bis(2,2-diethoxyethyl)phosphoryl]-1,1-diethoxyethane |
|---|---|
| PubChem CID | 14740209 |
| Molecular Formula | C18H39O7P |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 2-[bis(2,2-diethoxyethyl)phosphoryl]-1,1-diethoxyethane |
| SMILES | CCOC(CP(=O)(CC(OCC)OCC)CC(OCC)OCC)OCC |
| InChI | InChI=1S/C18H39O7P/c1-7-20-16(21-8-2)13-26(19,14-17(22-9-3)23-10-4)15-18(24-11-5)25-12-6/h16-18H,7-15H2,1-6H3 |
| InChIKey | KERMSHRKVHWQJI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|