C6H14O4P+ — CID 172806023
2,2-diethoxyethoxy(oxo)phosphanium (PubChem CID 172806023) has the molecular formula C6H14O4P+ and a molecular weight of 181.15 g/mol. Its IUPAC name is 2,2-diethoxyethoxy(oxo)phosphanium.
| Compound Name | 2,2-diethoxyethoxy(oxo)phosphanium |
|---|---|
| PubChem CID | 172806023 |
| Molecular Formula | C6H14O4P+ |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 2,2-diethoxyethoxy(oxo)phosphanium |
| SMILES | CCOC(CO[PH+]=O)OCC |
| InChI | InChI=1S/C6H14O4P/c1-3-8-6(9-4-2)5-10-11-7/h6,11H,3-5H2,1-2H3/q+1 |
| InChIKey | YTYRXFDFUBLNAX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|