C8H16O4 — CID 15582210
2-(2,2-diethoxyethoxy)acetaldehyde (PubChem CID 15582210) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-(2,2-diethoxyethoxy)acetaldehyde.
| Compound Name | 2-(2,2-diethoxyethoxy)acetaldehyde |
|---|---|
| PubChem CID | 15582210 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-(2,2-diethoxyethoxy)acetaldehyde |
| SMILES | CCOC(COCC=O)OCC |
| InChI | InChI=1S/C8H16O4/c1-3-11-8(12-4-2)7-10-6-5-9/h5,8H,3-4,6-7H2,1-2H3 |
| InChIKey | UOTLRUAJNZVKJV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|