C11H22O3 — CID 14358530
1-(2,2-diethoxyethoxy)-3-methylbut-2-ene (PubChem CID 14358530) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 1-(2,2-diethoxyethoxy)-3-methylbut-2-ene.
| Compound Name | 1-(2,2-diethoxyethoxy)-3-methylbut-2-ene |
|---|---|
| PubChem CID | 14358530 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 1-(2,2-diethoxyethoxy)-3-methylbut-2-ene |
| SMILES | CCOC(COCC=C(C)C)OCC |
| InChI | InChI=1S/C11H22O3/c1-5-13-11(14-6-2)9-12-8-7-10(3)4/h7,11H,5-6,8-9H2,1-4H3 |
| InChIKey | XMOCPACVJFBYDU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|