C14H28O3 — CID 174481809
butane-1,1-diol;3-methyl-1-(3-methylbut-2-enoxy)but-2-ene (PubChem CID 174481809) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is butane-1,1-diol;3-methyl-1-(3-methylbut-2-enoxy)but-2-ene.
| Compound Name | butane-1,1-diol;3-methyl-1-(3-methylbut-2-enoxy)but-2-ene |
|---|---|
| PubChem CID | 174481809 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | butane-1,1-diol;3-methyl-1-(3-methylbut-2-enoxy)but-2-ene |
| SMILES | CC(C)=CCOCC=C(C)C.CCCC(O)O |
| InChI | InChI=1S/C10H18O.C4H10O2/c1-9(2)5-7-11-8-6-10(3)4;1-2-3-4(5)6/h5-6H,7-8H2,1-4H3;4-6H,2-3H2,1H3 |
| InChIKey | JHKDDPVAIRNNOQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|