About CID 57451317
CID 57451317 (PubChem CID 57451317) has the molecular formula C6H13AlO2
and a molecular weight of 144.15 g/mol.
Molecular Properties
| Compound Name | CID 57451317 |
| PubChem CID | 57451317 |
| Molecular Formula | C6H13AlO2 |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | — |
| SMILES | CCOC(C[Al])OCC |
| InChI | InChI=1S/C6H13O2.Al/c1-4-7-6(3)8-5-2;/h6H,3-5H2,1-2H3; |
| InChIKey | MZXBLWOJQPZWIG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 57451317 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57451317?
The IUPAC name of CID 57451317 (CID 57451317) is not available.
What is the SMILES notation for CID 57451317?
The canonical SMILES for CID 57451317 is CCOC(C[Al])OCC.
What is the InChIKey of CID 57451317?
The InChIKey is MZXBLWOJQPZWIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O2.Al/c1-4-7-6(3)8-5-2;/h6H,3-5H2,1-2H3;.
What are the key properties of CID 57451317?
CID 57451317 has a molecular weight of 144.15 g/mol, XLogP of 0.97, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57451317 is sourced from PubChem (CID 57451317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).