C14H22O3 — CID 13416780
2-(2,2-diethoxyethoxy)-1,3-dimethylbenzene (PubChem CID 13416780) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-(2,2-diethoxyethoxy)-1,3-dimethylbenzene.
| Compound Name | 2-(2,2-diethoxyethoxy)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 13416780 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-(2,2-diethoxyethoxy)-1,3-dimethylbenzene |
| SMILES | CCOC(COc1c(C)cccc1C)OCC |
| InChI | InChI=1S/C14H22O3/c1-5-15-13(16-6-2)10-17-14-11(3)8-7-9-12(14)4/h7-9,13H,5-6,10H2,1-4H3 |
| InChIKey | ZNANXJOSAHPDCF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|