C15H23NO4 — CID 65471375
4-(2,2-diethoxyethoxy)-3,5-dimethylbenzamide (PubChem CID 65471375) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-(2,2-diethoxyethoxy)-3,5-dimethylbenzamide.
| Compound Name | 4-(2,2-diethoxyethoxy)-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 65471375 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-(2,2-diethoxyethoxy)-3,5-dimethylbenzamide |
| SMILES | CCOC(COc1c(C)cc(C(N)=O)cc1C)OCC |
| InChI | InChI=1S/C15H23NO4/c1-5-18-13(19-6-2)9-20-14-10(3)7-12(15(16)17)8-11(14)4/h7-8,13H,5-6,9H2,1-4H3,(H2,16,17) |
| InChIKey | OJDRJXOIMKAFSQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|