C13H18O4 — CID 60886659
4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid (PubChem CID 60886659) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid.
| Compound Name | 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 60886659 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid |
| SMILES | CCC(O)COc1c(C)cc(C(=O)O)cc1C |
| InChI | InChI=1S/C13H18O4/c1-4-11(14)7-17-12-8(2)5-10(13(15)16)6-9(12)3/h5-6,11,14H,4,7H2,1-3H3,(H,15,16) |
| InChIKey | CTYASQXVJHKGAH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |