4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid

C13H18O4 — CID 60886659

IUPAC4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid
SMILESCCC(O)COc1c(C)cc(C(=O)O)cc1C
InChIInChI=1S/C13H18O4/c1-4-11(14)7-17-12-8(2)5-10(13(15)16)6-9(12)3/h5-6,11,14H,4,7H2,1-3H3,(H,15,16)
InChIKeyCTYASQXVJHKGAH-UHFFFAOYSA-N
MW238.28 g/mol
LogP2.15
Rot. Bonds5

About 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid

4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid (PubChem CID 60886659) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid.

Molecular Properties

Compound Name4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid
PubChem CID60886659
Molecular FormulaC13H18O4
Molecular Weight238.28 g/mol
Exact Mass238.12
IUPAC Name4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid
SMILESCCC(O)COc1c(C)cc(C(=O)O)cc1C
InChIInChI=1S/C13H18O4/c1-4-11(14)7-17-12-8(2)5-10(13(15)16)6-9(12)3/h5-6,11,14H,4,7H2,1-3H3,(H,15,16)
InChIKeyCTYASQXVJHKGAH-UHFFFAOYSA-N
XLogP2.15
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.28
LogP ≤ 52.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid?
The IUPAC name of 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid (CID 60886659) is 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid.
What is the SMILES notation for 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid?
The canonical SMILES for 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid is CCC(O)COc1c(C)cc(C(=O)O)cc1C.
What is the InChIKey of 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid?
The InChIKey is CTYASQXVJHKGAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-4-11(14)7-17-12-8(2)5-10(13(15)16)6-9(12)3/h5-6,11,14H,4,7H2,1-3H3,(H,15,16).
What are the key properties of 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid?
4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid has a molecular weight of 238.28 g/mol, XLogP of 2.15, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxybutoxy)-3,5-dimethylbenzoic acid is sourced from PubChem (CID 60886659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).