C12H13F3O3 — CID 64552924
3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid (PubChem CID 64552924) has the molecular formula C12H13F3O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid.
| Compound Name | 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid |
|---|---|
| PubChem CID | 64552924 |
| Molecular Formula | C12H13F3O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(C)c1OCCC(F)(F)F |
| InChI | InChI=1S/C12H13F3O3/c1-7-5-9(11(16)17)6-8(2)10(7)18-4-3-12(13,14)15/h5-6H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | MRHAZNNIFSYBMB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |