3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid

C12H13F3O3 — CID 64552924

IUPAC3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid
SMILESCc1cc(C(=O)O)cc(C)c1OCCC(F)(F)F
InChIInChI=1S/C12H13F3O3/c1-7-5-9(11(16)17)6-8(2)10(7)18-4-3-12(13,14)15/h5-6H,3-4H2,1-2H3,(H,16,17)
InChIKeyMRHAZNNIFSYBMB-UHFFFAOYSA-N
MW262.23 g/mol
LogP3.33
Rot. Bonds4

About 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid

3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid (PubChem CID 64552924) has the molecular formula C12H13F3O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid.

Molecular Properties

Compound Name3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid
PubChem CID64552924
Molecular FormulaC12H13F3O3
Molecular Weight262.23 g/mol
Exact Mass262.08
IUPAC Name3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid
SMILESCc1cc(C(=O)O)cc(C)c1OCCC(F)(F)F
InChIInChI=1S/C12H13F3O3/c1-7-5-9(11(16)17)6-8(2)10(7)18-4-3-12(13,14)15/h5-6H,3-4H2,1-2H3,(H,16,17)
InChIKeyMRHAZNNIFSYBMB-UHFFFAOYSA-N
XLogP3.33
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.23
LogP ≤ 53.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid?
The IUPAC name of 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid (CID 64552924) is 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid.
What is the SMILES notation for 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid?
The canonical SMILES for 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid is Cc1cc(C(=O)O)cc(C)c1OCCC(F)(F)F.
What is the InChIKey of 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid?
The InChIKey is MRHAZNNIFSYBMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O3/c1-7-5-9(11(16)17)6-8(2)10(7)18-4-3-12(13,14)15/h5-6H,3-4H2,1-2H3,(H,16,17).
What are the key properties of 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid?
3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid has a molecular weight of 262.23 g/mol, XLogP of 3.33, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-(3,3,3-trifluoropropoxy)benzoic acid is sourced from PubChem (CID 64552924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).