C12H19NO3 — CID 81089807
3-(2,2-diethoxyethoxy)aniline (PubChem CID 81089807) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-(2,2-diethoxyethoxy)aniline.
| Compound Name | 3-(2,2-diethoxyethoxy)aniline |
|---|---|
| PubChem CID | 81089807 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 3-(2,2-diethoxyethoxy)aniline |
| SMILES | CCOC(COc1cccc(N)c1)OCC |
| InChI | InChI=1S/C12H19NO3/c1-3-14-12(15-4-2)9-16-11-7-5-6-10(13)8-11/h5-8,12H,3-4,9,13H2,1-2H3 |
| InChIKey | MAWLYQOKVLFWCQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|