C13H19BrO3 — CID 83141135
1-bromo-4-(2,2-diethoxyethoxy)-2-methylbenzene (PubChem CID 83141135) has the molecular formula C13H19BrO3 and a molecular weight of 303.20 g/mol. Its IUPAC name is 1-bromo-4-(2,2-diethoxyethoxy)-2-methylbenzene.
| Compound Name | 1-bromo-4-(2,2-diethoxyethoxy)-2-methylbenzene |
|---|---|
| PubChem CID | 83141135 |
| Molecular Formula | C13H19BrO3 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-bromo-4-(2,2-diethoxyethoxy)-2-methylbenzene |
| SMILES | CCOC(COc1ccc(Br)c(C)c1)OCC |
| InChI | InChI=1S/C13H19BrO3/c1-4-15-13(16-5-2)9-17-11-6-7-12(14)10(3)8-11/h6-8,13H,4-5,9H2,1-3H3 |
| InChIKey | OFEZXTISMDDNGD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|