C13H19BrO — CID 64995498
2-[2-(bromomethyl)butoxy]-1,3-dimethylbenzene (PubChem CID 64995498) has the molecular formula C13H19BrO and a molecular weight of 271.20 g/mol. Its IUPAC name is 2-[2-(bromomethyl)butoxy]-1,3-dimethylbenzene.
| Compound Name | 2-[2-(bromomethyl)butoxy]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 64995498 |
| Molecular Formula | C13H19BrO |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-[2-(bromomethyl)butoxy]-1,3-dimethylbenzene |
| SMILES | CCC(CBr)COc1c(C)cccc1C |
| InChI | InChI=1S/C13H19BrO/c1-4-12(8-14)9-15-13-10(2)6-5-7-11(13)3/h5-7,12H,4,8-9H2,1-3H3 |
| InChIKey | DXRQJBQCBPYAHG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|