C15H25NO — CID 62040818
1-(2,6-dimethylphenoxy)-N-propylbutan-2-amine (PubChem CID 62040818) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-(2,6-dimethylphenoxy)-N-propylbutan-2-amine.
| Compound Name | 1-(2,6-dimethylphenoxy)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 62040818 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 1-(2,6-dimethylphenoxy)-N-propylbutan-2-amine |
| SMILES | CCCNC(CC)COc1c(C)cccc1C |
| InChI | InChI=1S/C15H25NO/c1-5-10-16-14(6-2)11-17-15-12(3)8-7-9-13(15)4/h7-9,14,16H,5-6,10-11H2,1-4H3 |
| InChIKey | NIMVUENRFLQRMK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |