C13H19F2NO — CID 63268869
1-(2,5-difluorophenoxy)-N-propylbutan-2-amine (PubChem CID 63268869) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 1-(2,5-difluorophenoxy)-N-propylbutan-2-amine.
| Compound Name | 1-(2,5-difluorophenoxy)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 63268869 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(2,5-difluorophenoxy)-N-propylbutan-2-amine |
| SMILES | CCCNC(CC)COc1cc(F)ccc1F |
| InChI | InChI=1S/C13H19F2NO/c1-3-7-16-11(4-2)9-17-13-8-10(14)5-6-12(13)15/h5-6,8,11,16H,3-4,7,9H2,1-2H3 |
| InChIKey | WENHEQXWXWTGBU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |