C13H19F2NO2 — CID 64898653
4-(2,5-difluorophenoxy)-3-(propylamino)butan-1-ol (PubChem CID 64898653) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 4-(2,5-difluorophenoxy)-3-(propylamino)butan-1-ol.
| Compound Name | 4-(2,5-difluorophenoxy)-3-(propylamino)butan-1-ol |
|---|---|
| PubChem CID | 64898653 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-(2,5-difluorophenoxy)-3-(propylamino)butan-1-ol |
| SMILES | CCCNC(CCO)COc1cc(F)ccc1F |
| InChI | InChI=1S/C13H19F2NO2/c1-2-6-16-11(5-7-17)9-18-13-8-10(14)3-4-12(13)15/h3-4,8,11,16-17H,2,5-7,9H2,1H3 |
| InChIKey | YGRLQPLMAANZPR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |