C12H15F2NO2 — CID 64809098
2-(cyclopropylamino)-3-(2,5-difluorophenoxy)propan-1-ol (PubChem CID 64809098) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-(cyclopropylamino)-3-(2,5-difluorophenoxy)propan-1-ol.
| Compound Name | 2-(cyclopropylamino)-3-(2,5-difluorophenoxy)propan-1-ol |
|---|---|
| PubChem CID | 64809098 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-(cyclopropylamino)-3-(2,5-difluorophenoxy)propan-1-ol |
| SMILES | OCC(COc1cc(F)ccc1F)NC1CC1 |
| InChI | InChI=1S/C12H15F2NO2/c13-8-1-4-11(14)12(5-8)17-7-10(6-16)15-9-2-3-9/h1,4-5,9-10,15-16H,2-3,6-7H2 |
| InChIKey | LHOIRYNFDHACFD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |