C13H15F2NO3 — CID 63269768
2-(cyclopropylamino)-4-(2,5-difluorophenoxy)butanoic acid (PubChem CID 63269768) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 2-(cyclopropylamino)-4-(2,5-difluorophenoxy)butanoic acid.
| Compound Name | 2-(cyclopropylamino)-4-(2,5-difluorophenoxy)butanoic acid |
|---|---|
| PubChem CID | 63269768 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-(cyclopropylamino)-4-(2,5-difluorophenoxy)butanoic acid |
| SMILES | O=C(O)C(CCOc1cc(F)ccc1F)NC1CC1 |
| InChI | InChI=1S/C13H15F2NO3/c14-8-1-4-10(15)12(7-8)19-6-5-11(13(17)18)16-9-2-3-9/h1,4,7,9,11,16H,2-3,5-6H2,(H,17,18) |
| InChIKey | LOKXOCPLZGEPGG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |