C13H16F2N2O2 — CID 63038366
2-(cyclopropylamino)-4-(2,3-difluorophenoxy)butanamide (PubChem CID 63038366) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-(cyclopropylamino)-4-(2,3-difluorophenoxy)butanamide.
| Compound Name | 2-(cyclopropylamino)-4-(2,3-difluorophenoxy)butanamide |
|---|---|
| PubChem CID | 63038366 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(cyclopropylamino)-4-(2,3-difluorophenoxy)butanamide |
| SMILES | NC(=O)C(CCOc1cccc(F)c1F)NC1CC1 |
| InChI | InChI=1S/C13H16F2N2O2/c14-9-2-1-3-11(12(9)15)19-7-6-10(13(16)18)17-8-4-5-8/h1-3,8,10,17H,4-7H2,(H2,16,18) |
| InChIKey | WXSMFSOPLLIPGI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |