C13H22N2 — CID 63202116
1-(3-methyl-2-pyridinyl)-N-propylbutan-2-amine (PubChem CID 63202116) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(3-methyl-2-pyridinyl)-N-propylbutan-2-amine.
| Compound Name | 1-(3-methyl-2-pyridinyl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 63202116 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-(3-methyl-2-pyridinyl)-N-propylbutan-2-amine |
| SMILES | CCCNC(CC)Cc1ncccc1C |
| InChI | InChI=1S/C13H22N2/c1-4-8-14-12(5-2)10-13-11(3)7-6-9-15-13/h6-7,9,12,14H,4-5,8,10H2,1-3H3 |
| InChIKey | UNSLRZPZOCOCLD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |