C13H21FN2 — CID 63198137
1-(3-fluoro-2-pyridinyl)-N-propylpentan-2-amine (PubChem CID 63198137) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 1-(3-fluoro-2-pyridinyl)-N-propylpentan-2-amine.
| Compound Name | 1-(3-fluoro-2-pyridinyl)-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 63198137 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 1-(3-fluoro-2-pyridinyl)-N-propylpentan-2-amine |
| SMILES | CCCNC(CCC)Cc1ncccc1F |
| InChI | InChI=1S/C13H21FN2/c1-3-6-11(15-8-4-2)10-13-12(14)7-5-9-16-13/h5,7,9,11,15H,3-4,6,8,10H2,1-2H3 |
| InChIKey | DAWLIZNCMXKLAT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |