About ethane;2-ethoxy-1,3-dimethylbenzene
ethane;2-ethoxy-1,3-dimethylbenzene (PubChem CID 91163284) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;2-ethoxy-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | ethane;2-ethoxy-1,3-dimethylbenzene |
| PubChem CID | 91163284 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | ethane;2-ethoxy-1,3-dimethylbenzene |
| SMILES | CC.CCOc1c(C)cccc1C |
| InChI | InChI=1S/C10H14O.C2H6/c1-4-11-10-8(2)6-5-7-9(10)3;1-2/h5-7H,4H2,1-3H3;1-2H3 |
| InChIKey | YCUKXXZKGVSXLI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethoxy-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethoxy-1,3-dimethylbenzene?
The IUPAC name of ethane;2-ethoxy-1,3-dimethylbenzene (CID 91163284) is ethane;2-ethoxy-1,3-dimethylbenzene.
What is the SMILES notation for ethane;2-ethoxy-1,3-dimethylbenzene?
The canonical SMILES for ethane;2-ethoxy-1,3-dimethylbenzene is CC.CCOc1c(C)cccc1C.
What is the InChIKey of ethane;2-ethoxy-1,3-dimethylbenzene?
The InChIKey is YCUKXXZKGVSXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C2H6/c1-4-11-10-8(2)6-5-7-9(10)3;1-2/h5-7H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;2-ethoxy-1,3-dimethylbenzene?
ethane;2-ethoxy-1,3-dimethylbenzene has a molecular weight of 180.29 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethoxy-1,3-dimethylbenzene is sourced from PubChem (CID 91163284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).