C10H14AlCl3O — CID 175224495
2-ethoxy-1,3-dimethylbenzene;trichloroalumane (PubChem CID 175224495) has the molecular formula C10H14AlCl3O and a molecular weight of 283.56 g/mol. Its IUPAC name is 2-ethoxy-1,3-dimethylbenzene;trichloroalumane.
| Compound Name | 2-ethoxy-1,3-dimethylbenzene;trichloroalumane |
|---|---|
| PubChem CID | 175224495 |
| Molecular Formula | C10H14AlCl3O |
| Molecular Weight | 283.56 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 2-ethoxy-1,3-dimethylbenzene;trichloroalumane |
| SMILES | CCOc1c(C)cccc1C.Cl[Al](Cl)Cl |
| InChI | InChI=1S/C10H14O.Al.3ClH/c1-4-11-10-8(2)6-5-7-9(10)3;;;;/h5-7H,4H2,1-3H3;;3*1H/q;+3;;;/p-3 |
| InChIKey | VRNFFTIQIFJQDM-UHFFFAOYSA-K |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |