C10H13AlCl2O — CID 163214352
dichloro-[2-(2,6-dimethylphenoxy)ethyl]alumane (PubChem CID 163214352) has the molecular formula C10H13AlCl2O and a molecular weight of 247.10 g/mol. Its IUPAC name is dichloro-[2-(2,6-dimethylphenoxy)ethyl]alumane.
| Compound Name | dichloro-[2-(2,6-dimethylphenoxy)ethyl]alumane |
|---|---|
| PubChem CID | 163214352 |
| Molecular Formula | C10H13AlCl2O |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | dichloro-[2-(2,6-dimethylphenoxy)ethyl]alumane |
| SMILES | Cc1cccc(C)c1OCC[Al](Cl)Cl |
| InChI | InChI=1S/C10H13O.Al.2ClH/c1-4-11-10-8(2)6-5-7-9(10)3;;;/h5-7H,1,4H2,2-3H3;;2*1H/q;+2;;/p-2 |
| InChIKey | AOAXDKOBQIFZBR-UHFFFAOYSA-L |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |