C10H16N2O — CID 82125287
2-(2,6-dimethylphenoxy)ethylhydrazine (PubChem CID 82125287) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)ethylhydrazine.
| Compound Name | 2-(2,6-dimethylphenoxy)ethylhydrazine |
|---|---|
| PubChem CID | 82125287 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)ethylhydrazine |
| SMILES | Cc1cccc(C)c1OCCNN |
| InChI | InChI=1S/C10H16N2O/c1-8-4-3-5-9(2)10(8)13-7-6-12-11/h3-5,12H,6-7,11H2,1-2H3 |
| InChIKey | MNSGECSGBCXBAD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|