C8H10Cl2N2O — CID 3798878
2-(2,6-dichlorophenoxy)ethylhydrazine (PubChem CID 3798878) has the molecular formula C8H10Cl2N2O and a molecular weight of 221.09 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethylhydrazine.
| Compound Name | 2-(2,6-dichlorophenoxy)ethylhydrazine |
|---|---|
| PubChem CID | 3798878 |
| Molecular Formula | C8H10Cl2N2O |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethylhydrazine |
| SMILES | NNCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H10Cl2N2O/c9-6-2-1-3-7(10)8(6)13-5-4-12-11/h1-3,12H,4-5,11H2 |
| InChIKey | ISFRQPYFMIVDTO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|