C12H17Cl2NO2 — CID 62599266
N-[2-(2,6-dichlorophenoxy)ethyl]-2-ethoxyethanamine (PubChem CID 62599266) has the molecular formula C12H17Cl2NO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is N-[2-(2,6-dichlorophenoxy)ethyl]-2-ethoxyethanamine.
| Compound Name | N-[2-(2,6-dichlorophenoxy)ethyl]-2-ethoxyethanamine |
|---|---|
| PubChem CID | 62599266 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | N-[2-(2,6-dichlorophenoxy)ethyl]-2-ethoxyethanamine |
| SMILES | CCOCCNCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H17Cl2NO2/c1-2-16-8-6-15-7-9-17-12-10(13)4-3-5-11(12)14/h3-5,15H,2,6-9H2,1H3 |
| InChIKey | WIAUQJWPWCUULU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|