C13H12BrCl2NOS — CID 63517673
N-[(4-bromothiophen-2-yl)methyl]-2-(2,6-dichlorophenoxy)ethanamine (PubChem CID 63517673) has the molecular formula C13H12BrCl2NOS and a molecular weight of 381.12 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(2,6-dichlorophenoxy)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2,6-dichlorophenoxy)ethanamine |
|---|---|
| PubChem CID | 63517673 |
| Molecular Formula | C13H12BrCl2NOS |
| Molecular Weight | 381.12 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2,6-dichlorophenoxy)ethanamine |
| SMILES | Clc1cccc(Cl)c1OCCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C13H12BrCl2NOS/c14-9-6-10(19-8-9)7-17-4-5-18-13-11(15)2-1-3-12(13)16/h1-3,6,8,17H,4-5,7H2 |
| InChIKey | RBLSNDBYNBXZGD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.12 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|