C13H12BrF2NOS — CID 55112857
N-[(4-bromothiophen-2-yl)methyl]-2-(3,5-difluorophenoxy)ethanamine (PubChem CID 55112857) has the molecular formula C13H12BrF2NOS and a molecular weight of 348.21 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(3,5-difluorophenoxy)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(3,5-difluorophenoxy)ethanamine |
|---|---|
| PubChem CID | 55112857 |
| Molecular Formula | C13H12BrF2NOS |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(3,5-difluorophenoxy)ethanamine |
| SMILES | Fc1cc(F)cc(OCCNCc2cc(Br)cs2)c1 |
| InChI | InChI=1S/C13H12BrF2NOS/c14-9-3-13(19-8-9)7-17-1-2-18-12-5-10(15)4-11(16)6-12/h3-6,8,17H,1-2,7H2 |
| InChIKey | NEELNUDDVGNGKP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|