C14H15Br2NOS — CID 107286383
2-(5-bromo-2-methylphenoxy)-N-[(4-bromothiophen-2-yl)methyl]ethanamine (PubChem CID 107286383) has the molecular formula C14H15Br2NOS and a molecular weight of 405.16 g/mol. Its IUPAC name is 2-(5-bromo-2-methylphenoxy)-N-[(4-bromothiophen-2-yl)methyl]ethanamine.
| Compound Name | 2-(5-bromo-2-methylphenoxy)-N-[(4-bromothiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107286383 |
| Molecular Formula | C14H15Br2NOS |
| Molecular Weight | 405.16 g/mol |
| Exact Mass | 402.92 |
| IUPAC Name | 2-(5-bromo-2-methylphenoxy)-N-[(4-bromothiophen-2-yl)methyl]ethanamine |
| SMILES | Cc1ccc(Br)cc1OCCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C14H15Br2NOS/c1-10-2-3-11(15)7-14(10)18-5-4-17-8-13-6-12(16)9-19-13/h2-3,6-7,9,17H,4-5,8H2,1H3 |
| InChIKey | FNVWJWAWBQSCAJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.16 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|