C16H18BrNOS — CID 63517390
N-[(4-bromothiophen-2-yl)methyl]-2-(2-prop-2-enylphenoxy)ethanamine (PubChem CID 63517390) has the molecular formula C16H18BrNOS and a molecular weight of 352.30 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(2-prop-2-enylphenoxy)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-prop-2-enylphenoxy)ethanamine |
|---|---|
| PubChem CID | 63517390 |
| Molecular Formula | C16H18BrNOS |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-prop-2-enylphenoxy)ethanamine |
| SMILES | C=CCc1ccccc1OCCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C16H18BrNOS/c1-2-5-13-6-3-4-7-16(13)19-9-8-18-11-15-10-14(17)12-20-15/h2-4,6-7,10,12,18H,1,5,8-9,11H2 |
| InChIKey | CIZZHOHAISTONA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|