C14H16BrNS — CID 78911495
N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylphenyl)ethanamine (PubChem CID 78911495) has the molecular formula C14H16BrNS and a molecular weight of 310.26 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylphenyl)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 78911495 |
| Molecular Formula | C14H16BrNS |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylphenyl)ethanamine |
| SMILES | Cc1ccccc1CCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C14H16BrNS/c1-11-4-2-3-5-12(11)6-7-16-9-14-8-13(15)10-17-14/h2-5,8,10,16H,6-7,9H2,1H3 |
| InChIKey | PNJRUMGXECEBOL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|