C16H20BrNOS — CID 63516198
N-[(4-bromothiophen-2-yl)methyl]-2-(2,4,6-trimethylphenoxy)ethanamine (PubChem CID 63516198) has the molecular formula C16H20BrNOS and a molecular weight of 354.31 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(2,4,6-trimethylphenoxy)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2,4,6-trimethylphenoxy)ethanamine |
|---|---|
| PubChem CID | 63516198 |
| Molecular Formula | C16H20BrNOS |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2,4,6-trimethylphenoxy)ethanamine |
| SMILES | Cc1cc(C)c(OCCNCc2cc(Br)cs2)c(C)c1 |
| InChI | InChI=1S/C16H20BrNOS/c1-11-6-12(2)16(13(3)7-11)19-5-4-18-9-15-8-14(17)10-20-15/h6-8,10,18H,4-5,9H2,1-3H3 |
| InChIKey | DFSHYIJYVUJDIM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|