C11H18BrNO2S — CID 28834395
N-[(4-bromothiophen-2-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine (PubChem CID 28834395) has the molecular formula C11H18BrNO2S and a molecular weight of 308.24 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine |
|---|---|
| PubChem CID | 28834395 |
| Molecular Formula | C11H18BrNO2S |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine |
| SMILES | COCCOCCCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C11H18BrNO2S/c1-14-5-6-15-4-2-3-13-8-11-7-10(12)9-16-11/h7,9,13H,2-6,8H2,1H3 |
| InChIKey | ICLLJTBDADGAPE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|