C11H15Cl2NO — CID 60800210
3-(2,6-dichlorophenoxy)-N-ethylpropan-1-amine (PubChem CID 60800210) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is 3-(2,6-dichlorophenoxy)-N-ethylpropan-1-amine.
| Compound Name | 3-(2,6-dichlorophenoxy)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 60800210 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 3-(2,6-dichlorophenoxy)-N-ethylpropan-1-amine |
| SMILES | CCNCCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H15Cl2NO/c1-2-14-7-4-8-15-11-9(12)5-3-6-10(11)13/h3,5-6,14H,2,4,7-8H2,1H3 |
| InChIKey | GXMUAYGJIGPBAM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|