C14H19Cl2NO3 — CID 79810253
2-[2-(2,6-dichlorophenoxy)ethylamino]-2-ethylbutanoic acid (PubChem CID 79810253) has the molecular formula C14H19Cl2NO3 and a molecular weight of 320.22 g/mol. Its IUPAC name is 2-[2-(2,6-dichlorophenoxy)ethylamino]-2-ethylbutanoic acid.
| Compound Name | 2-[2-(2,6-dichlorophenoxy)ethylamino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 79810253 |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[2-(2,6-dichlorophenoxy)ethylamino]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(NCCOc1c(Cl)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H19Cl2NO3/c1-3-14(4-2,13(18)19)17-8-9-20-12-10(15)6-5-7-11(12)16/h5-7,17H,3-4,8-9H2,1-2H3,(H,18,19) |
| InChIKey | FNFNLMWLOYCAQI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|