C11H10Cl2O4S — CID 151968365
2-(2,6-dichlorophenyl)sulfanyl-2-ethylpropanedioic acid (PubChem CID 151968365) has the molecular formula C11H10Cl2O4S and a molecular weight of 309.17 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)sulfanyl-2-ethylpropanedioic acid.
| Compound Name | 2-(2,6-dichlorophenyl)sulfanyl-2-ethylpropanedioic acid |
|---|---|
| PubChem CID | 151968365 |
| Molecular Formula | C11H10Cl2O4S |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | 2-(2,6-dichlorophenyl)sulfanyl-2-ethylpropanedioic acid |
| SMILES | CCC(Sc1c(Cl)cccc1Cl)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H10Cl2O4S/c1-2-11(9(14)15,10(16)17)18-8-6(12)4-3-5-7(8)13/h3-5H,2H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | UADLEESFIGQIPL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|