C8H8ClNO2S — CID 61318232
2-(2-amino-6-chlorophenyl)sulfanylacetic acid (PubChem CID 61318232) has the molecular formula C8H8ClNO2S and a molecular weight of 217.68 g/mol. Its IUPAC name is 2-(2-amino-6-chlorophenyl)sulfanylacetic acid.
| Compound Name | 2-(2-amino-6-chlorophenyl)sulfanylacetic acid |
|---|---|
| PubChem CID | 61318232 |
| Molecular Formula | C8H8ClNO2S |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 2-(2-amino-6-chlorophenyl)sulfanylacetic acid |
| SMILES | Nc1cccc(Cl)c1SCC(=O)O |
| InChI | InChI=1S/C8H8ClNO2S/c9-5-2-1-3-6(10)8(5)13-4-7(11)12/h1-3H,4,10H2,(H,11,12) |
| InChIKey | OAWFHDDEZYJEEB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|