C13H19Br2NO — CID 62598982
N-[2-(2,6-dibromophenoxy)ethyl]-2-methylbutan-2-amine (PubChem CID 62598982) has the molecular formula C13H19Br2NO and a molecular weight of 365.11 g/mol. Its IUPAC name is N-[2-(2,6-dibromophenoxy)ethyl]-2-methylbutan-2-amine.
| Compound Name | N-[2-(2,6-dibromophenoxy)ethyl]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 62598982 |
| Molecular Formula | C13H19Br2NO |
| Molecular Weight | 365.11 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | N-[2-(2,6-dibromophenoxy)ethyl]-2-methylbutan-2-amine |
| SMILES | CCC(C)(C)NCCOc1c(Br)cccc1Br |
| InChI | InChI=1S/C13H19Br2NO/c1-4-13(2,3)16-8-9-17-12-10(14)6-5-7-11(12)15/h5-7,16H,4,8-9H2,1-3H3 |
| InChIKey | UAYMJGNSKIQGNP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.11 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|