C15H23Br2NO — CID 63505607
N-[2-(2,6-dibromophenoxy)ethyl]-5-methylhexan-2-amine (PubChem CID 63505607) has the molecular formula C15H23Br2NO and a molecular weight of 393.16 g/mol. Its IUPAC name is N-[2-(2,6-dibromophenoxy)ethyl]-5-methylhexan-2-amine.
| Compound Name | N-[2-(2,6-dibromophenoxy)ethyl]-5-methylhexan-2-amine |
|---|---|
| PubChem CID | 63505607 |
| Molecular Formula | C15H23Br2NO |
| Molecular Weight | 393.16 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | N-[2-(2,6-dibromophenoxy)ethyl]-5-methylhexan-2-amine |
| SMILES | CC(C)CCC(C)NCCOc1c(Br)cccc1Br |
| InChI | InChI=1S/C15H23Br2NO/c1-11(2)7-8-12(3)18-9-10-19-15-13(16)5-4-6-14(15)17/h4-6,11-12,18H,7-10H2,1-3H3 |
| InChIKey | NEPCIFLYAFLKCP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.16 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|