C9H12Cl2N2O — CID 82291003
1-(2,6-dichlorophenoxy)propan-2-ylhydrazine (PubChem CID 82291003) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is 1-(2,6-dichlorophenoxy)propan-2-ylhydrazine.
| Compound Name | 1-(2,6-dichlorophenoxy)propan-2-ylhydrazine |
|---|---|
| PubChem CID | 82291003 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1-(2,6-dichlorophenoxy)propan-2-ylhydrazine |
| SMILES | CC(COc1c(Cl)cccc1Cl)NN |
| InChI | InChI=1S/C9H12Cl2N2O/c1-6(13-12)5-14-9-7(10)3-2-4-8(9)11/h2-4,6,13H,5,12H2,1H3 |
| InChIKey | RZTUQLLYDNHGCJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|