C11H18N2O3 — CID 112512168
1-(2,6-dimethoxyphenoxy)propan-2-ylhydrazine (PubChem CID 112512168) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenoxy)propan-2-ylhydrazine.
| Compound Name | 1-(2,6-dimethoxyphenoxy)propan-2-ylhydrazine |
|---|---|
| PubChem CID | 112512168 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-(2,6-dimethoxyphenoxy)propan-2-ylhydrazine |
| SMILES | COc1cccc(OC)c1OCC(C)NN |
| InChI | InChI=1S/C11H18N2O3/c1-8(13-12)7-16-11-9(14-2)5-4-6-10(11)15-3/h4-6,8,13H,7,12H2,1-3H3 |
| InChIKey | OLKKFWAPKAXDMZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|