C14H23NO3 — CID 62450721
3-(2,6-dimethoxyphenoxy)-N-ethyl-2-methylpropan-1-amine (PubChem CID 62450721) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenoxy)-N-ethyl-2-methylpropan-1-amine.
| Compound Name | 3-(2,6-dimethoxyphenoxy)-N-ethyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62450721 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-(2,6-dimethoxyphenoxy)-N-ethyl-2-methylpropan-1-amine |
| SMILES | CCNCC(C)COc1c(OC)cccc1OC |
| InChI | InChI=1S/C14H23NO3/c1-5-15-9-11(2)10-18-14-12(16-3)7-6-8-13(14)17-4/h6-8,11,15H,5,9-10H2,1-4H3 |
| InChIKey | JNCLPLFDMXXBET-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |