C10H12Cl2O3 — CID 66224051
1,3-dichloro-2-(2,2-dimethoxyethoxy)benzene (PubChem CID 66224051) has the molecular formula C10H12Cl2O3 and a molecular weight of 251.11 g/mol. Its IUPAC name is 1,3-dichloro-2-(2,2-dimethoxyethoxy)benzene.
| Compound Name | 1,3-dichloro-2-(2,2-dimethoxyethoxy)benzene |
|---|---|
| PubChem CID | 66224051 |
| Molecular Formula | C10H12Cl2O3 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 1,3-dichloro-2-(2,2-dimethoxyethoxy)benzene |
| SMILES | COC(COc1c(Cl)cccc1Cl)OC |
| InChI | InChI=1S/C10H12Cl2O3/c1-13-9(14-2)6-15-10-7(11)4-3-5-8(10)12/h3-5,9H,6H2,1-2H3 |
| InChIKey | VXSXPCHVTMOSPA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|