C13H16ClNO2 — CID 121393338
4-chloro-1-(3,3-dimethoxypropyl)indole (PubChem CID 121393338) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 4-chloro-1-(3,3-dimethoxypropyl)indole.
| Compound Name | 4-chloro-1-(3,3-dimethoxypropyl)indole |
|---|---|
| PubChem CID | 121393338 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-chloro-1-(3,3-dimethoxypropyl)indole |
| SMILES | COC(CCn1ccc2c(Cl)cccc21)OC |
| InChI | InChI=1S/C13H16ClNO2/c1-16-13(17-2)7-9-15-8-6-10-11(14)4-3-5-12(10)15/h3-6,8,13H,7,9H2,1-2H3 |
| InChIKey | QTBVDMUBTMQWFR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|