C17H16ClN — CID 116623712
4-chloro-1-[(3,5-dimethylphenyl)methyl]indole (PubChem CID 116623712) has the molecular formula C17H16ClN and a molecular weight of 269.78 g/mol. Its IUPAC name is 4-chloro-1-[(3,5-dimethylphenyl)methyl]indole.
| Compound Name | 4-chloro-1-[(3,5-dimethylphenyl)methyl]indole |
|---|---|
| PubChem CID | 116623712 |
| Molecular Formula | C17H16ClN |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-chloro-1-[(3,5-dimethylphenyl)methyl]indole |
| SMILES | Cc1cc(C)cc(Cn2ccc3c(Cl)cccc32)c1 |
| InChI | InChI=1S/C17H16ClN/c1-12-8-13(2)10-14(9-12)11-19-7-6-15-16(18)4-3-5-17(15)19/h3-10H,11H2,1-2H3 |
| InChIKey | FMIYTTJZZKTRLF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |